Products 38559-92-1
CAS 38559-92-1 appears in our catalog under these names: 4-Benzyloxyphenoxyacetic acid, 96%, 4-Benzyloxyphenoxyacetic acid/ 97%, 2-(4-(benzyloxy)phenoxy)acetic acid, 2-(4-(Benzyloxy)phenoxy)acetic acid 98%, 4-Benzyloxyphenoxyacetic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 2,5g, 0,25g, 100mg, 250mg.
2-(4-phenylmethoxyphenoxy)acetic acid (CAS 38559-92-1) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 2-(4-phenylmethoxyphenoxy)acetic acid. InChIKey: VXMSXBVTUNOSLL-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-(4-phenylmethoxyphenoxy)acetic acid |
| InChIKey | VXMSXBVTUNOSLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(Phenylmethoxy)phenoxy)acetic acid, [4-(phenylmethoxy)phenoxy]acetic acid, 4-Benzyloxyphenoxyacetic acid, [4-(benzyloxy)phenoxy]acetic acid, 4-(Benzyloxy)phenoxyacetic acid, 2-[4-(benzyloxy)phenoxy]acetic acid, 2-(4-(benzyloxy)phenoxy)acetic acid, 2-(4-phenylmethoxyphenoxy)acetic acid, 2-[4-(Phenylmethoxy)phenoxy]-acetic acid, Acetic acid, [4-(phenylmethoxy)phenoxy]-