CAS 36896-99-8 appears in our catalog under these names: 2-Benzoyl-4,5-dimethoxyphenol, 98%, (2-Hydroxy-4,5-dimethoxyphenyl)(phenyl)methanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2-hydroxy-4,5-dimethoxyphenyl)-phenylmethanone (CAS 36896-99-8) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: (2-hydroxy-4,5-dimethoxyphenyl)-phenylmethanone. InChIKey: LUIQQENNUNILQJ-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2-hydroxy-4,5-dimethoxyphenyl)-phenylmethanone |
| InChIKey | LUIQQENNUNILQJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)C2=CC=CC=C2)O)OC |
Computed by PubChem (NCBI)