cas: 26475-66-1 — see every product listed under this CAS number, including other names
4-Benzylthiomorpholine 1,1-dioxide (CAS 26475-66-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F403659-1G |
| cas | 26475-66-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 372.80 Pln |
| delivery time | 3-4 weeks |
|---|
4-benzyl-1,4-thiazinane 1,1-dioxide (CAS 26475-66-1) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 4-benzyl-1,4-thiazinane 1,1-dioxide. InChIKey: KFAMTQFKYUXQKV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 4-benzyl-1,4-thiazinane 1,1-dioxide |
| InChIKey | KFAMTQFKYUXQKV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)