CAS 1367706-03-3 is the registry number for Amino[4-(isopropylsulfanyl)phenyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-2-(4-propan-2-ylsulfanylphenyl)acetic acid (CAS 1367706-03-3) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 2-amino-2-(4-propan-2-ylsulfanylphenyl)acetic acid. InChIKey: PWKSUWUZCSCTDM-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 2-amino-2-(4-propan-2-ylsulfanylphenyl)acetic acid |
| InChIKey | PWKSUWUZCSCTDM-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=CC=C(C=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)