Products 1367706-03-3

CAS 1367706-03-3 is the registry number for Amino[4-(isopropylsulfanyl)phenyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-2-(4-propan-2-ylsulfanylphenyl)acetic acid (CAS 1367706-03-3) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 2-amino-2-(4-propan-2-ylsulfanylphenyl)acetic acid. InChIKey: PWKSUWUZCSCTDM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO2S
Molecular weight225.31 g/mol
IUPAC name2-amino-2-(4-propan-2-ylsulfanylphenyl)acetic acid
InChIKeyPWKSUWUZCSCTDM-UHFFFAOYSA-N
SMILESCC(C)SC1=CC=C(C=C1)C(C(=O)O)N

Computed by PubChem (NCBI)