CAS 26475-66-1 appears in our catalog under these names: 4-Benzylthiomorpholine 1,1-dioxide, 95%, 4-Benzylthiomorpholine 1,1-dioxide, 97%, 4–Benzylthiomorpholine 1,1–Dioxide, 4-Benzylthiomorpholine 1,1-dioxide, 97% , 4-Benzylthiomorpholine 1,1-Dioxide, >98.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific, TCI. Available pack sizes: 25g, 1g, 5g, 10g.
4-benzyl-1,4-thiazinane 1,1-dioxide (CAS 26475-66-1) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 4-benzyl-1,4-thiazinane 1,1-dioxide. InChIKey: KFAMTQFKYUXQKV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 4-benzyl-1,4-thiazinane 1,1-dioxide |
| InChIKey | KFAMTQFKYUXQKV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)