CAS 231953-31-4 is the registry number for 1,3-Dibromo-2-methyl-5-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
1,3-dibromo-2-methyl-5-(trifluoromethyl)benzene (CAS 231953-31-4) is a chemical compound with the molecular formula C8H5Br2F3 and a molecular weight of 317.93 g/mol. IUPAC name: 1,3-dibromo-2-methyl-5-(trifluoromethyl)benzene. InChIKey: PYNWLQMFGMGAHM-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3 |
|---|---|
| Molecular weight | 317.93 g/mol |
| IUPAC name | 1,3-dibromo-2-methyl-5-(trifluoromethyl)benzene |
| InChIKey | PYNWLQMFGMGAHM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)