CAS 875664-32-7 is the registry number for 1-Bromo-2-(bromomethyl)-4-(tert-butyl)benzene, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-bromo-2-(bromomethyl)-4-(trifluoromethyl)benzene (CAS 875664-32-7) is a chemical compound with the molecular formula C8H5Br2F3 and a molecular weight of 317.93 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-4-(trifluoromethyl)benzene. InChIKey: TXJHPBWTPBYLFP-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3 |
|---|---|
| Molecular weight | 317.93 g/mol |
| IUPAC name | 1-bromo-2-(bromomethyl)-4-(trifluoromethyl)benzene |
| InChIKey | TXJHPBWTPBYLFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CBr)Br |
Computed by PubChem (NCBI)