cas: 37742-98-6 — see every product listed under this CAS number, including other names
4-Bromo-2,2-diphenylbutyric Acid, >98.0%(T) (CAS 37742-98-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3597-5G |
| cas | 37742-98-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 157.68 Pln | |
| TCI | 25g | 457.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
4-bromo-2,2-diphenylbutanoic acid (CAS 37742-98-6) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: 4-bromo-2,2-diphenylbutanoic acid. InChIKey: GFIYIIRFIODLLU-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | 4-bromo-2,2-diphenylbutanoic acid |
| InChIKey | GFIYIIRFIODLLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCBr)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)