cas: 53965-69-8 — see every product listed under this CAS number, including other names
4-Bromo-2,3,5,6-tetramethylaniline 97% (CAS 53965-69-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A353245-100mg |
| cas | 53965-69-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 1905.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A353245 |
4-bromo-2,3,5,6-tetramethylaniline (CAS 53965-69-8) is a chemical compound with the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. IUPAC name: 4-bromo-2,3,5,6-tetramethylaniline. InChIKey: VENKISSLGWHCOE-UHFFFAOYSA-N.
| Molecular formula | C10H14BrN |
|---|---|
| Molecular weight | 228.13 g/mol |
| IUPAC name | 4-bromo-2,3,5,6-tetramethylaniline |
| InChIKey | VENKISSLGWHCOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1N)C)C)Br)C |
Computed by PubChem (NCBI)