cas: 626238-73-1 — see every product listed under this CAS number, including other names
4-Bromo-2,3-difluoro-6-nitroaniline 98% (CAS 626238-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A804899-100g |
| cas | 626238-73-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 20184.00 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 1766.56 Pln | |
| Ambeed | 10g | 3084.88 Pln | |
| Ambeed | 25g | 5727.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A804899 |
4-bromo-2,3-difluoro-6-nitroaniline (CAS 626238-73-1) is a chemical compound with the molecular formula C6H3BrF2N2O2 and a molecular weight of 253.00 g/mol. IUPAC name: 4-bromo-2,3-difluoro-6-nitroaniline. InChIKey: UEQDRXXHEPIYMV-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF2N2O2 |
|---|---|
| Molecular weight | 253.00 g/mol |
| IUPAC name | 4-bromo-2,3-difluoro-6-nitroaniline |
| InChIKey | UEQDRXXHEPIYMV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)