cas: 893420-23-0 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-N-methylbenzamide 98% (CAS 893420-23-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A375991-25mg |
| cas | 893420-23-0 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 220.19 Pln | |
| Ambeed | 50mg | 325.88 Pln | |
| Ambeed | 100mg | 503.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A375991 |
4-bromo-2-chloro-N-methylbenzamide (CAS 893420-23-0) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 4-bromo-2-chloro-N-methylbenzamide. InChIKey: UFLXVXIDMCMCCF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 4-bromo-2-chloro-N-methylbenzamide |
| InChIKey | UFLXVXIDMCMCCF-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)