Products 1272731-95-9
CAS 1272731-95-9 is the registry number for (R)-6-Bromo-7-chloro-2,3-dihydrobenzofuran-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3R)-6-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-amine (CAS 1272731-95-9) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: (3R)-6-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: CPOQLCLUXZJVHX-LURJTMIESA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | (3R)-6-bromo-7-chloro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | CPOQLCLUXZJVHX-LURJTMIESA-N |
| SMILES | C1[C@@H](C2=C(O1)C(=C(C=C2)Br)Cl)N |
Computed by PubChem (NCBI)