CAS 435273-54-4 is the registry number for Methyl 5-bromo-2-chlorobenzamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
5-bromo-2-chloro-N-methylbenzamide (CAS 435273-54-4) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 5-bromo-2-chloro-N-methylbenzamide. InChIKey: JKYTZJSGPWNIRB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 5-bromo-2-chloro-N-methylbenzamide |
| InChIKey | JKYTZJSGPWNIRB-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)