cas: 182344-57-6 — see every product listed under this CAS number, including other names
4-Bromo-2-chlorobenzo[d]thiazole 97% (CAS 182344-57-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145270-100mg |
| cas | 182344-57-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 25g | 3424.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A145270 |
4-bromo-2-chloro-1,3-benzothiazole (CAS 182344-57-6) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 4-bromo-2-chloro-1,3-benzothiazole. InChIKey: HWPFBBVUHHRYMR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 4-bromo-2-chloro-1,3-benzothiazole |
| InChIKey | HWPFBBVUHHRYMR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(S2)Cl |
Computed by PubChem (NCBI)