cas: 175278-24-7 — see every product listed under this CAS number, including other names
4-Bromo-2-ethylbenzene-1-sulfonyl chloride, 95% (CAS 175278-24-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | TL00690DA |
| cas | 175278-24-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 176.14 Pln | |
| Thermo Scientific | 10g | 1267.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
4-bromo-2-ethylbenzenesulfonyl chloride (CAS 175278-24-7) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 4-bromo-2-ethylbenzenesulfonyl chloride. InChIKey: UOIVESXBURLTPX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 4-bromo-2-ethylbenzenesulfonyl chloride |
| InChIKey | UOIVESXBURLTPX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)