CAS 180200-86-6 appears in our catalog under these names: 1-(Bromomethyl)-2-chloro-4-(methylsulfonyl)benzene, 98%, 1-(Bromomethyl)-2-chloro-4-(methylsulfonyl)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g.
1-(bromomethyl)-2-chloro-4-methylsulfonylbenzene (CAS 180200-86-6) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 1-(bromomethyl)-2-chloro-4-methylsulfonylbenzene. InChIKey: FQVJALWTFNYNBL-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 1-(bromomethyl)-2-chloro-4-methylsulfonylbenzene |
| InChIKey | FQVJALWTFNYNBL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)CBr)Cl |
Computed by PubChem (NCBI)