Products 175278-24-7
CAS 175278-24-7 appears in our catalog under these names: 4-Bromo-2-ethylbenzene-1-sulfonyl chloride, 98%, 4-Bromo-2-ethylbenzene-1-sulfonyl chloride, 98+%, 4-Bromo-2-ethylbenzene-1-sulfonyl chloride, 4-Bromo-2-ethylbenzene-1-sulfonyl chloride, 95% , 4-Bromo-2-ethylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Chemat Brand, Biosynth, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 5g, on request, 10g.
4-bromo-2-ethylbenzenesulfonyl chloride (CAS 175278-24-7) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 4-bromo-2-ethylbenzenesulfonyl chloride. InChIKey: UOIVESXBURLTPX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 4-bromo-2-ethylbenzenesulfonyl chloride |
| InChIKey | UOIVESXBURLTPX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)