cas: 91659-03-9 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-3-hydroxybenzoic acid 97% (CAS 91659-03-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A612363-100mg |
| cas | 91659-03-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1482.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A612363 |
4-bromo-2-fluoro-3-hydroxybenzoic acid (CAS 91659-03-9) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 4-bromo-2-fluoro-3-hydroxybenzoic acid. InChIKey: ZFSHBUDHIVXAMP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-hydroxybenzoic acid |
| InChIKey | ZFSHBUDHIVXAMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)O)Br |
Computed by PubChem (NCBI)