CAS 91659-18-6 appears in our catalog under these names: 4-Bromo-2-fluoro-5-hydroxybenzoic acid, 95%, 4-Bromo-2-fluoro-5-hydroxybenzoic acid, 95+%, Benzoic acid, 4-bromo-2-fluoro-5-hydroxy-, 4-Bromo-2-fluoro-5-hydroxybenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-bromo-2-fluoro-5-hydroxybenzoic acid (CAS 91659-18-6) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 4-bromo-2-fluoro-5-hydroxybenzoic acid. InChIKey: YJWYQJFRTMPNFX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-hydroxybenzoic acid |
| InChIKey | YJWYQJFRTMPNFX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)Br)F)C(=O)O |
Computed by PubChem (NCBI)