CAS 1807144-55-3 is the registry number for 5-bromo-2-fluoro-3-hydroxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-bromo-2-fluoro-3-hydroxybenzoic acid (CAS 1807144-55-3) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 5-bromo-2-fluoro-3-hydroxybenzoic acid. InChIKey: RHANSFOBTGNDQC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-hydroxybenzoic acid |
| InChIKey | RHANSFOBTGNDQC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)O)Br |
Computed by PubChem (NCBI)