Products 1807144-55-3

CAS 1807144-55-3 is the registry number for 5-bromo-2-fluoro-3-hydroxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-2-fluoro-3-hydroxybenzoic acid (CAS 1807144-55-3) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 5-bromo-2-fluoro-3-hydroxybenzoic acid. InChIKey: RHANSFOBTGNDQC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrFO3
Molecular weight235.01 g/mol
IUPAC name5-bromo-2-fluoro-3-hydroxybenzoic acid
InChIKeyRHANSFOBTGNDQC-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)F)O)Br

Computed by PubChem (NCBI)