cas: 104460-70-0 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-5-(trifluoromethyl)aniline 97% (CAS 104460-70-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115771-250mg |
| cas | 104460-70-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1327.12 Pln | |
| Ambeed | 500g | 5098.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A115771 |
4-bromo-2-fluoro-5-(trifluoromethyl)aniline (CAS 104460-70-0) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 4-bromo-2-fluoro-5-(trifluoromethyl)aniline. InChIKey: UYVDMCXPDGRLEC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-(trifluoromethyl)aniline |
| InChIKey | UYVDMCXPDGRLEC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)F)Br)C(F)(F)F |
Computed by PubChem (NCBI)