cas: 87547-06-6 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-5-nitroaniline, 96%, 96% (CAS 87547-06-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115DDC-100mg |
| cas | 87547-06-6 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 25g | 851.60 Pln | |
| Chemat | 100g | 2181.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-fluoro-5-nitroaniline (CAS 87547-06-6) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 4-bromo-2-fluoro-5-nitroaniline. InChIKey: PDNZCDDWSKYNTE-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-nitroaniline |
| InChIKey | PDNZCDDWSKYNTE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)F)N |
Computed by PubChem (NCBI)