cas: 875664-46-3 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-6-(trifluoromethyl)aniline, 98% (CAS 875664-46-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A514673-250mg |
| cas | 875664-46-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 838.18 Pln | |
| AmBeed | 10g | 4724.65 Pln | |
| AmBeed | 25g | 10004.26 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-2-fluoro-6-(trifluoromethyl)aniline (CAS 875664-46-3) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 4-bromo-2-fluoro-6-(trifluoromethyl)aniline. InChIKey: FWIDRROZQFRPCM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-6-(trifluoromethyl)aniline |
| InChIKey | FWIDRROZQFRPCM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)F)Br |
Computed by PubChem (NCBI)