cas: 502496-34-6 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-6-nitrotoluene 98% (CAS 502496-34-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A329275-100mg |
| cas | 502496-34-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1722.06 Pln | |
| Ambeed | 500g | 8308.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A329275 |
5-bromo-1-fluoro-2-methyl-3-nitrobenzene (CAS 502496-34-6) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 5-bromo-1-fluoro-2-methyl-3-nitrobenzene. InChIKey: QZUIGBPWEFMEEV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 5-bromo-1-fluoro-2-methyl-3-nitrobenzene |
| InChIKey | QZUIGBPWEFMEEV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)