cas: 1799973-80-0 — see every product listed under this CAS number, including other names
4-Bromo-2-methoxy-N-methyl-6-nitroaniline, 97% (CAS 1799973-80-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A286036-5g |
| cas | 1799973-80-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 19899.46 Pln | |
| Fluorochem | 100mg | 1788.97 Pln | |
| Fluorochem | 250mg | 2923.99 Pln | |
| Fluorochem | 1g | 5782.36 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-2-methoxy-N-methyl-6-nitroaniline (CAS 1799973-80-0) is a chemical compound with the molecular formula C8H9BrN2O3 and a molecular weight of 261.07 g/mol. IUPAC name: 4-bromo-2-methoxy-N-methyl-6-nitroaniline. InChIKey: DOBMDBUZZCNJAY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O3 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 4-bromo-2-methoxy-N-methyl-6-nitroaniline |
| InChIKey | DOBMDBUZZCNJAY-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1OC)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)