CAS 854227-37-5 appears in our catalog under these names: 2-[(5-Bromo-2-nitrophenyl)amino]ethan-1-ol, 95%, 2-[(5-Bromo-2-nitrophenyl)amino]ethan-1-ol, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(5-bromo-2-nitroanilino)ethanol (CAS 854227-37-5) is a chemical compound with the molecular formula C8H9BrN2O3 and a molecular weight of 261.07 g/mol. IUPAC name: 2-(5-bromo-2-nitroanilino)ethanol. InChIKey: STLXYDWVBIZQAQ-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O3 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 2-(5-bromo-2-nitroanilino)ethanol |
| InChIKey | STLXYDWVBIZQAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)NCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)