Products 859850-57-0

CAS 859850-57-0 is the registry number for 3-(4-Bromo-1H-pyrrole-2-carboxamido)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]propanoic acid (CAS 859850-57-0) is a chemical compound with the molecular formula C8H9BrN2O3 and a molecular weight of 261.07 g/mol. IUPAC name: 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]propanoic acid. InChIKey: WFIPCSWZHFEYIV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BrN2O3
Molecular weight261.07 g/mol
IUPAC name3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]propanoic acid
InChIKeyWFIPCSWZHFEYIV-UHFFFAOYSA-N
SMILESC1=C(NC=C1Br)C(=O)NCCC(=O)O

Computed by PubChem (NCBI)