cas: 71785-48-3 — see every product listed under this CAS number, including other names
4-Bromo-2-methyl-5-nitroaniline 98% (CAS 71785-48-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A238780-1g |
| cas | 71785-48-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 670.75 Pln | |
| Ambeed | 25g | 1299.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A238780 |
4-bromo-2-methyl-5-nitroaniline (CAS 71785-48-3) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 4-bromo-2-methyl-5-nitroaniline. InChIKey: VNSOWZDCHBKTGR-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 4-bromo-2-methyl-5-nitroaniline |
| InChIKey | VNSOWZDCHBKTGR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)