cas: 16588-25-3 — see every product listed under this CAS number, including other names
4-Bromo-2-nitro-N-phenylbenzenamine, 98%, 98% (CAS 16588-25-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQJ0-1g |
| cas | 16588-25-3 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 808.40 Pln | |
| Chemat | 5g | 2752.40 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 453.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-nitro-N-phenylaniline (CAS 16588-25-3) is a chemical compound with the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. IUPAC name: 4-bromo-2-nitro-N-phenylaniline. InChIKey: YYBRRJVPEFDOOE-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O2 |
|---|---|
| Molecular weight | 293.12 g/mol |
| IUPAC name | 4-bromo-2-nitro-N-phenylaniline |
| InChIKey | YYBRRJVPEFDOOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)