cas: 16588-25-3 — see every product listed under this CAS number, including other names
4-BROMO-2-NITRO-N-PHENYL-ANILINE, 98% (CAS 16588-25-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300728-100MG |
| cas | 16588-25-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1044.44 Pln | |
| Fluorochem | 5g | 3632.07 Pln | |
| Fluorochem | 10g | 4485.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-nitro-N-phenylaniline (CAS 16588-25-3) is a chemical compound with the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. IUPAC name: 4-bromo-2-nitro-N-phenylaniline. InChIKey: YYBRRJVPEFDOOE-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O2 |
|---|---|
| Molecular weight | 293.12 g/mol |
| IUPAC name | 4-bromo-2-nitro-N-phenylaniline |
| InChIKey | YYBRRJVPEFDOOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)