Products 1480715-50-1
CAS 1480715-50-1 is the registry number for 4-(4-Bromophenyl)-2-methylpyrimidine-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-bromophenyl)-2-methylpyrimidine-5-carboxylic acid (CAS 1480715-50-1) is a chemical compound with the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. IUPAC name: 4-(4-bromophenyl)-2-methylpyrimidine-5-carboxylic acid. InChIKey: HIWGGGGXNDHPEE-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O2 |
|---|---|
| Molecular weight | 293.12 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2-methylpyrimidine-5-carboxylic acid |
| InChIKey | HIWGGGGXNDHPEE-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=N1)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)