cas: 112734-21-1 — see every product listed under this CAS number, including other names
4-Bromo-2-nitrobenzoyl chloride 95% (CAS 112734-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130969-250mg |
| cas | 112734-21-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 2222.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A130969 |
4-bromo-2-nitrobenzoyl chloride (CAS 112734-21-1) is a chemical compound with the molecular formula C7H3BrClNO3 and a molecular weight of 264.46 g/mol. IUPAC name: 4-bromo-2-nitrobenzoyl chloride. InChIKey: NTHPXJQLZIGPLM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO3 |
|---|---|
| Molecular weight | 264.46 g/mol |
| IUPAC name | 4-bromo-2-nitrobenzoyl chloride |
| InChIKey | NTHPXJQLZIGPLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)