CAS 112734-21-1 appears in our catalog under these names: 4-Bromo-2-nitrobenzoyl chloride, 95%, 4–Bromo–2–nitrobenzoyl chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 5g, 250mg.
4-bromo-2-nitrobenzoyl chloride (CAS 112734-21-1) is a chemical compound with the molecular formula C7H3BrClNO3 and a molecular weight of 264.46 g/mol. IUPAC name: 4-bromo-2-nitrobenzoyl chloride. InChIKey: NTHPXJQLZIGPLM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO3 |
|---|---|
| Molecular weight | 264.46 g/mol |
| IUPAC name | 4-bromo-2-nitrobenzoyl chloride |
| InChIKey | NTHPXJQLZIGPLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)