cas: 112734-21-1 — see every product listed under this CAS number, including other names
4–Bromo–2–nitrobenzoyl chloride (CAS 112734-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF26497-100mg |
| cas | 112734-21-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 512.79 Pln | |
| GLPBio | 1g | 882.55 Pln | |
| GLPBio | 250mg | 587.68 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-2-nitrobenzoyl chloride (CAS 112734-21-1) is a chemical compound with the molecular formula C7H3BrClNO3 and a molecular weight of 264.46 g/mol. IUPAC name: 4-bromo-2-nitrobenzoyl chloride. InChIKey: NTHPXJQLZIGPLM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO3 |
|---|---|
| Molecular weight | 264.46 g/mol |
| IUPAC name | 4-bromo-2-nitrobenzoyl chloride |
| InChIKey | NTHPXJQLZIGPLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)