cas: 1451393-32-0 — see every product listed under this CAS number, including other names
4-Bromo-3-carboxyphenylboronic acid (CAS 1451393-32-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627969-1G |
| cas | 1451393-32-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1752.53 Pln | |
| Fluorochem | 5g | 5095.10 Pln |
| delivery time | 3-4 weeks |
|---|
5-borono-2-bromobenzoic acid (CAS 1451393-32-0) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: 5-borono-2-bromobenzoic acid. InChIKey: LWXLTIPQWGSHKH-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | 5-borono-2-bromobenzoic acid |
| InChIKey | LWXLTIPQWGSHKH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)C(=O)O)(O)O |
Computed by PubChem (NCBI)