cas: 1160574-68-4 — see every product listed under this CAS number, including other names
4-Bromo-3-chloro-2-fluorobenzonitrile 98% (CAS 1160574-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A773021-100mg |
| cas | 1160574-68-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 2139.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A773021 |
4-bromo-3-chloro-2-fluorobenzonitrile (CAS 1160574-68-4) is a chemical compound with the molecular formula C7H2BrClFN and a molecular weight of 234.45 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluorobenzonitrile. InChIKey: PQFMVBRXNPGOQP-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClFN |
|---|---|
| Molecular weight | 234.45 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluorobenzonitrile |
| InChIKey | PQFMVBRXNPGOQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)F)Cl)Br |
Computed by PubChem (NCBI)