cas: 1160574-68-4 — see every product listed under this CAS number, including other names
4-Bromo-3-chloro-2-fluorobenzonitrile, 98% (CAS 1160574-68-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037522-250MG |
| cas | 1160574-68-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 2528.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-3-chloro-2-fluorobenzonitrile (CAS 1160574-68-4) is a chemical compound with the molecular formula C7H2BrClFN and a molecular weight of 234.45 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluorobenzonitrile. InChIKey: PQFMVBRXNPGOQP-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClFN |
|---|---|
| Molecular weight | 234.45 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluorobenzonitrile |
| InChIKey | PQFMVBRXNPGOQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)F)Cl)Br |
Computed by PubChem (NCBI)