CAS 1160574-15-1 appears in our catalog under these names: 3-Bromo-5-chloro-2-fluorobenzonitrile, 95%, 3-Bromo-5-chloro-2-fluorobenzonitrile, 95+%, 3-Bromo-5-chloro-2-fluorobenzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
3-bromo-5-chloro-2-fluorobenzonitrile (CAS 1160574-15-1) is a chemical compound with the molecular formula C7H2BrClFN and a molecular weight of 234.45 g/mol. IUPAC name: 3-bromo-5-chloro-2-fluorobenzonitrile. InChIKey: RELFACQQRCJQOV-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClFN |
|---|---|
| Molecular weight | 234.45 g/mol |
| IUPAC name | 3-bromo-5-chloro-2-fluorobenzonitrile |
| InChIKey | RELFACQQRCJQOV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)F)Br)Cl |
Computed by PubChem (NCBI)