Products 1824089-00-0
CAS 1824089-00-0 is the registry number for 5-Bromo-4-chloro-2-fluorobenzonitrile, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-bromo-4-chloro-2-fluorobenzonitrile (CAS 1824089-00-0) is a chemical compound with the molecular formula C7H2BrClFN and a molecular weight of 234.45 g/mol. IUPAC name: 5-bromo-4-chloro-2-fluorobenzonitrile. InChIKey: OCWBEXYTQWBJFI-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClFN |
|---|---|
| Molecular weight | 234.45 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-fluorobenzonitrile |
| InChIKey | OCWBEXYTQWBJFI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)F)C#N |
Computed by PubChem (NCBI)