cas: 2121514-78-9 — see every product listed under this CAS number, including other names
4-Bromo-3-chloro-2-methylphenylboronic acid (CAS 2121514-78-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627674-1G |
| cas | 2121514-78-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1986.82 Pln | |
| Fluorochem | 5g | 5813.60 Pln |
| delivery time | 3-4 weeks |
|---|
(4-bromo-3-chloro-2-methylphenyl)boronic acid (CAS 2121514-78-9) is a chemical compound with the molecular formula C7H7BBrClO2 and a molecular weight of 249.30 g/mol. IUPAC name: (4-bromo-3-chloro-2-methylphenyl)boronic acid. InChIKey: YZPOZPMOVWCDEQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO2 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (4-bromo-3-chloro-2-methylphenyl)boronic acid |
| InChIKey | YZPOZPMOVWCDEQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Br)Cl)C)(O)O |
Computed by PubChem (NCBI)