cas: 914225-58-4 — see every product listed under this CAS number, including other names
4-Bromo-3-chloro-5-(trifluoromethyl)aniline 96% (CAS 914225-58-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499777-25g |
| cas | 914225-58-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 2678.81 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 592.88 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A499777 |
4-bromo-3-chloro-5-(trifluoromethyl)aniline (CAS 914225-58-4) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 4-bromo-3-chloro-5-(trifluoromethyl)aniline. InChIKey: WBGPOJPMDVJESG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 4-bromo-3-chloro-5-(trifluoromethyl)aniline |
| InChIKey | WBGPOJPMDVJESG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Br)Cl)N |
Computed by PubChem (NCBI)