cas: 23056-44-2 — see every product listed under this CAS number, including other names
4-Bromo-3-nitropyridine 95% (CAS 23056-44-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323551-1g |
| cas | 23056-44-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1104.63 Pln | |
| Ambeed | 5g | 3090.44 Pln | |
| Ambeed | 10g | 4792.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A323551 |
4-bromo-3-nitropyridine (CAS 23056-44-2) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 4-bromo-3-nitropyridine. InChIKey: KVZNAGBWCCVHKG-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 4-bromo-3-nitropyridine |
| InChIKey | KVZNAGBWCCVHKG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)