CAS 39856-50-3 appears in our catalog under these names: Risdiplam Impurity 8, 5-Bromo-2-nitropyridine, 5–Bromo–2–nitropyridine, 5-Bromo-2-nitropyridine, 99%, 5-Bromo-2-nitropyridine, >98.0%(GC). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: on request, 1g, 25g, 5g, 100g, 500g, 250g, 1000g.
5-bromo-2-nitropyridine (CAS 39856-50-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 5-bromo-2-nitropyridine. InChIKey: ATXXLNCPVSUCNK-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 5-bromo-2-nitropyridine |
| InChIKey | ATXXLNCPVSUCNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)