CAS 23056-44-2 appears in our catalog under these names: 4-Bromo-3-nitropyridine, 98%, 4-Bromo-3-nitropyridine, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 25g.
4-bromo-3-nitropyridine (CAS 23056-44-2) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 4-bromo-3-nitropyridine. InChIKey: KVZNAGBWCCVHKG-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 4-bromo-3-nitropyridine |
| InChIKey | KVZNAGBWCCVHKG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)