cas: 1227494-05-4 — see every product listed under this CAS number, including other names
4-Bromo-5-(trifluoromethyl)pyridin-2-ol 95% (CAS 1227494-05-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139045-50mg |
| cas | 1227494-05-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 693.00 Pln | |
| Ambeed | 100mg | 1065.69 Pln | |
| Ambeed | 250mg | 1755.44 Pln | |
| Ambeed | 1g | 4514.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A139045 |
4-bromo-5-(trifluoromethyl)-1H-pyridin-2-one (CAS 1227494-05-4) is a chemical compound with the molecular formula C6H3BrF3NO and a molecular weight of 241.99 g/mol. IUPAC name: 4-bromo-5-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: SDZLGVPGAFSPAM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NO |
|---|---|
| Molecular weight | 241.99 g/mol |
| IUPAC name | 4-bromo-5-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | SDZLGVPGAFSPAM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CNC1=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)