4-Bromo-6-(tert-butyl)dibenzo[b,d]furan, 95%
cas: 1438391-33-3 — see every product listed under this CAS number, including other names
4-Bromo-6-(tert-butyl)dibenzo[b,d]furan, 95% (CAS 1438391-33-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 25g. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | HG-1470-5g |
| cas | 1438391-33-3 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 789.32 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 759.75 Pln | |
| Ambeed | 25g | 2473.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 25g | 2478.80 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 231.05 Pln | |
| BLDpharm | 5g | 814.18 Pln | |
| BLDpharm | 25g | 2657.98 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromo-6-tert-butyldibenzofuran (CAS 1438391-33-3) is a chemical compound with the molecular formula C16H15BrO and a molecular weight of 303.19 g/mol. IUPAC name: 4-bromo-6-tert-butyldibenzofuran. InChIKey: RGBGTPGFTMYLTA-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO |
|---|---|
| Molecular weight | 303.19 g/mol |
| IUPAC name | 4-bromo-6-tert-butyldibenzofuran |
| InChIKey | RGBGTPGFTMYLTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC2=C1OC3=C2C=CC=C3Br |
Computed by PubChem (NCBI)