cas: 62561-74-4 — see every product listed under this CAS number, including other names
4-Bromo-D-phenylalanine, 98%, 98% (CAS 62561-74-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144YG-1g |
| cas | 62561-74-4 |
| size | 1g |
| availability | 164.55g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 237.20 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1254.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-D-phenylalanine is the D-enantiomer of 4-bromophenylalanine. It is a 4-bromophenylalanine and a D-phenylalanine derivative. It is an enantiomer of a 4-bromo-L-phenylalanine.
Source: ChEBI
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-bromophenyl)propanoic acid |
| InChIKey | PEMUHKUIQHFMTH-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)Br |
Computed by PubChem (NCBI)