CAS 1603580-85-3 appears in our catalog under these names: 2-Amino-6-bromo-3,5-dimethylbenzoic acid, 95%, 2-Amino-6-bromo-3,5-dimethylbenzoic Acid, 98+%, 2-Amino-6-bromo-3,5-dimethylbenzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g.
2-amino-6-bromo-3,5-dimethylbenzoic acid (CAS 1603580-85-3) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 2-amino-6-bromo-3,5-dimethylbenzoic acid. InChIKey: FXJHSAVSFVZTMC-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 2-amino-6-bromo-3,5-dimethylbenzoic acid |
| InChIKey | FXJHSAVSFVZTMC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1N)C(=O)O)Br)C |
Computed by PubChem (NCBI)