CAS 479074-63-0 appears in our catalog under these names: (R)-3-Amino-3-(4-bromo-phenyl)-propionic acid, 95%, (R)–3–Amino–3–(4–bromophenyl)propanoic acid, (R)-3-Amino-3-(4-bromophenyl)propanoic acid, 98%, 98%, (R)-Ăź-(p-Bromophenyl)alanine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 25g, 50g, 100g.
(3R)-3-amino-3-(4-bromophenyl)propanoic acid (CAS 479074-63-0) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (3R)-3-amino-3-(4-bromophenyl)propanoic acid. InChIKey: RBOUYDUXPMAYMJ-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-bromophenyl)propanoic acid |
| InChIKey | RBOUYDUXPMAYMJ-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)Br |
Computed by PubChem (NCBI)