cas: 51332-24-2 — see every product listed under this CAS number, including other names
4-Bromo-N,N-dimethyl-3-(trifluoromethyl)aniline, 97% (CAS 51332-24-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214636-250MG |
| cas | 51332-24-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 502.97 Pln | |
| Fluorochem | 1g | 1674.43 Pln | |
| Fluorochem | 5g | 6089.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-N,N-dimethyl-3-(trifluoromethyl)aniline (CAS 51332-24-2) is a chemical compound with the molecular formula C9H9BrF3N and a molecular weight of 268.07 g/mol. IUPAC name: 4-bromo-N,N-dimethyl-3-(trifluoromethyl)aniline. InChIKey: DBSFECXQLNDZAX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3N |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 4-bromo-N,N-dimethyl-3-(trifluoromethyl)aniline |
| InChIKey | DBSFECXQLNDZAX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)